C16H15Br — CID 63470495
2-benzyl-1-bromo-2,3-dihydro-1H-indene (PubChem CID 63470495) has the molecular formula C16H15Br and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-benzyl-1-bromo-2,3-dihydro-1H-indene.
| Compound Name | 2-benzyl-1-bromo-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63470495 |
| Molecular Formula | C16H15Br |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-benzyl-1-bromo-2,3-dihydro-1H-indene |
| SMILES | BrC1c2ccccc2CC1Cc1ccccc1 |
| InChI | InChI=1S/C16H15Br/c17-16-14(10-12-6-2-1-3-7-12)11-13-8-4-5-9-15(13)16/h1-9,14,16H,10-11H2 |
| InChIKey | XVTUOXCRXVCGPK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|