C12H13BrN4 — CID 107052420
5-[(1-bromo-2,3-dihydro-1H-inden-2-yl)methyl]-2-methyltetrazole (PubChem CID 107052420) has the molecular formula C12H13BrN4 and a molecular weight of 293.17 g/mol. Its IUPAC name is 5-[(1-bromo-2,3-dihydro-1H-inden-2-yl)methyl]-2-methyltetrazole.
| Compound Name | 5-[(1-bromo-2,3-dihydro-1H-inden-2-yl)methyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 107052420 |
| Molecular Formula | C12H13BrN4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-[(1-bromo-2,3-dihydro-1H-inden-2-yl)methyl]-2-methyltetrazole |
| SMILES | Cn1nnc(CC2Cc3ccccc3C2Br)n1 |
| InChI | InChI=1S/C12H13BrN4/c1-17-15-11(14-16-17)7-9-6-8-4-2-3-5-10(8)12(9)13/h2-5,9,12H,6-7H2,1H3 |
| InChIKey | GEBJTZDXGWUQJJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|