C9H10BrN — CID 142687946
(1S)-1-bromo-2,3-dihydro-1H-inden-2-amine (PubChem CID 142687946) has the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. Its IUPAC name is (1S)-1-bromo-2,3-dihydro-1H-inden-2-amine.
| Compound Name | (1S)-1-bromo-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 142687946 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | (1S)-1-bromo-2,3-dihydro-1H-inden-2-amine |
| SMILES | NC1Cc2ccccc2[C@@H]1Br |
| InChI | InChI=1S/C9H10BrN/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9H,5,11H2/t8?,9-/m0/s1 |
| InChIKey | NSWLEHKFHVBFFR-GKAPJAKFSA-N |
| XLogP | 2.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|