C12H16O — CID 59880475
(2R)-1-ethoxy-2-methyl-2,3-dihydro-1H-indene (PubChem CID 59880475) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (2R)-1-ethoxy-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | (2R)-1-ethoxy-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 59880475 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2R)-1-ethoxy-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CCOC1c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C12H16O/c1-3-13-12-9(2)8-10-6-4-5-7-11(10)12/h4-7,9,12H,3,8H2,1-2H3/t9-,12?/m1/s1 |
| InChIKey | XSQHJVOINDGXQW-PKEIRNPWSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |