C11H13N3O — CID 130277539
(1S)-2-azido-1-ethoxy-2,3-dihydro-1H-indene (PubChem CID 130277539) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is (1S)-2-azido-1-ethoxy-2,3-dihydro-1H-indene.
| Compound Name | (1S)-2-azido-1-ethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 130277539 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (1S)-2-azido-1-ethoxy-2,3-dihydro-1H-indene |
| SMILES | CCO[C@H]1c2ccccc2CC1N=[N+]=[N-] |
| InChI | InChI=1S/C11H13N3O/c1-2-15-11-9-6-4-3-5-8(9)7-10(11)13-14-12/h3-6,10-11H,2,7H2,1H3/t10?,11-/m0/s1 |
| InChIKey | GHVLBXTYRUPITO-DTIOYNMSSA-N |
| XLogP | 3.00 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|