C9H9N3O2 — CID 135064362
2-azido-1-hydroperoxy-2,3-dihydro-1H-indene (PubChem CID 135064362) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-azido-1-hydroperoxy-2,3-dihydro-1H-indene.
| Compound Name | 2-azido-1-hydroperoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 135064362 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-azido-1-hydroperoxy-2,3-dihydro-1H-indene |
| SMILES | [N-]=[N+]=NC1Cc2ccccc2C1OO |
| InChI | InChI=1S/C9H9N3O2/c10-12-11-8-5-6-3-1-2-4-7(6)9(8)14-13/h1-4,8-9,13H,5H2 |
| InChIKey | MGMLYGYGOSIVJR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|