C8H7N3S — CID 86188795
2-azido-2,3-dihydro-1-benzothiophene (PubChem CID 86188795) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-azido-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-azido-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 86188795 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-azido-2,3-dihydro-1-benzothiophene |
| SMILES | [N-]=[N+]=NC1Cc2ccccc2S1 |
| InChI | InChI=1S/C8H7N3S/c9-11-10-8-5-6-3-1-2-4-7(6)12-8/h1-4,8H,5H2 |
| InChIKey | CWDPFCYOQPRJHQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|