C11H14S — CID 19855208
2,3-dimethyl-3,4-dihydro-2H-thiochromene (PubChem CID 19855208) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 2,3-dimethyl-3,4-dihydro-2H-thiochromene.
| Compound Name | 2,3-dimethyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 19855208 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,3-dimethyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC1Cc2ccccc2SC1C |
| InChI | InChI=1S/C11H14S/c1-8-7-10-5-3-4-6-11(10)12-9(8)2/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | DFBCQUWEFKAEOG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |