C14H11ClS — CID 102045962
2-(2-chlorophenyl)-2,3-dihydro-1-benzothiophene (PubChem CID 102045962) has the molecular formula C14H11ClS and a molecular weight of 246.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-(2-chlorophenyl)-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 102045962 |
| Molecular Formula | C14H11ClS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(2-chlorophenyl)-2,3-dihydro-1-benzothiophene |
| SMILES | Clc1ccccc1C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H11ClS/c15-12-7-3-2-6-11(12)14-9-10-5-1-4-8-13(10)16-14/h1-8,14H,9H2 |
| InChIKey | XTBFHODBNNETPU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |