C14H11ClS — CID 86310640
(5R)-5-chloro-5,6-dihydrobenzo[b][1]benzothiepine (PubChem CID 86310640) has the molecular formula C14H11ClS and a molecular weight of 246.76 g/mol. Its IUPAC name is (5R)-5-chloro-5,6-dihydrobenzo[b][1]benzothiepine.
| Compound Name | (5R)-5-chloro-5,6-dihydrobenzo[b][1]benzothiepine |
|---|---|
| PubChem CID | 86310640 |
| Molecular Formula | C14H11ClS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (5R)-5-chloro-5,6-dihydrobenzo[b][1]benzothiepine |
| SMILES | Cl[C@@H]1Cc2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C14H11ClS/c15-12-9-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8,12H,9H2/t12-/m1/s1 |
| InChIKey | NLQGARUWFXXYMD-GFCCVEGCSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|