C14H11ClS2 — CID 14361272
3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-thiol (PubChem CID 14361272) has the molecular formula C14H11ClS2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-thiol.
| Compound Name | 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-thiol |
|---|---|
| PubChem CID | 14361272 |
| Molecular Formula | C14H11ClS2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-thiol |
| SMILES | SC1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C14H11ClS2/c15-10-5-6-13-9(7-10)8-12(16)11-3-1-2-4-14(11)17-13/h1-7,12,16H,8H2 |
| InChIKey | CJIQWLISDOYFHC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|