About 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol
3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol (PubChem CID 14772340) has the molecular formula C17H18ClNOS
and a molecular weight of 319.86 g/mol. Its IUPAC name is 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol |
| PubChem CID | 14772340 |
| Molecular Formula | C17H18ClNOS |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol |
| SMILES | OCCCNC1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C17H18ClNOS/c18-13-6-7-16-12(10-13)11-15(19-8-3-9-20)14-4-1-2-5-17(14)21-16/h1-2,4-7,10,15,19-20H,3,8-9,11H2 |
| InChIKey | TYLLJBDLSGZJAU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol?
The IUPAC name of 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol (CID 14772340) is 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol is OCCCNC1Cc2cc(Cl)ccc2Sc2ccccc21.
What is the InChIKey of 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol?
The InChIKey is TYLLJBDLSGZJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClNOS/c18-13-6-7-16-12(10-13)11-15(19-8-3-9-20)14-4-1-2-5-17(14)21-16/h1-2,4-7,10,15,19-20H,3,8-9,11H2.
What are the key properties of 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol?
3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol has a molecular weight of 319.86 g/mol, XLogP of 4.06, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)amino]propan-1-ol is sourced from PubChem (CID 14772340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).