C15H11ClO2S — CID 12957333
3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid (PubChem CID 12957333) has the molecular formula C15H11ClO2S and a molecular weight of 290.77 g/mol. Its IUPAC name is 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid.
| Compound Name | 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid |
|---|---|
| PubChem CID | 12957333 |
| Molecular Formula | C15H11ClO2S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C15H11ClO2S/c16-10-5-6-13-9(7-10)8-12(15(17)18)11-3-1-2-4-14(11)19-13/h1-7,12H,8H2,(H,17,18) |
| InChIKey | IIIVMQCHIVUAKO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |