3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid

C15H11ClO2S — CID 12957333

IUPAC3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid
SMILESO=C(O)C1Cc2cc(Cl)ccc2Sc2ccccc21
InChIInChI=1S/C15H11ClO2S/c16-10-5-6-13-9(7-10)8-12(15(17)18)11-3-1-2-4-14(11)19-13/h1-7,12H,8H2,(H,17,18)
InChIKeyIIIVMQCHIVUAKO-UHFFFAOYSA-N
MW290.77 g/mol
LogP4.22
Rot. Bonds1

About 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid

3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid (PubChem CID 12957333) has the molecular formula C15H11ClO2S and a molecular weight of 290.77 g/mol. Its IUPAC name is 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid.

Molecular Properties

Compound Name3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid
PubChem CID12957333
Molecular FormulaC15H11ClO2S
Molecular Weight290.77 g/mol
Exact Mass290.02
IUPAC Name3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid
SMILESO=C(O)C1Cc2cc(Cl)ccc2Sc2ccccc21
InChIInChI=1S/C15H11ClO2S/c16-10-5-6-13-9(7-10)8-12(15(17)18)11-3-1-2-4-14(11)19-13/h1-7,12H,8H2,(H,17,18)
InChIKeyIIIVMQCHIVUAKO-UHFFFAOYSA-N
XLogP4.22
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.77
LogP ≤ 54.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid?
The IUPAC name of 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid (CID 12957333) is 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid.
What is the SMILES notation for 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid?
The canonical SMILES for 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid is O=C(O)C1Cc2cc(Cl)ccc2Sc2ccccc21.
What is the InChIKey of 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid?
The InChIKey is IIIVMQCHIVUAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO2S/c16-10-5-6-13-9(7-10)8-12(15(17)18)11-3-1-2-4-14(11)19-13/h1-7,12H,8H2,(H,17,18).
What are the key properties of 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid?
3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid has a molecular weight of 290.77 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-dihydrobenzo[b][1]benzothiepine-6-carboxylic acid is sourced from PubChem (CID 12957333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).