C18H20ClNS — CID 826443
(6S)-3-chloro-N,N-diethyl-5,6-dihydrobenzo[b][1]benzothiepin-6-amine (PubChem CID 826443) has the molecular formula C18H20ClNS and a molecular weight of 317.88 g/mol. Its IUPAC name is (6S)-3-chloro-N,N-diethyl-5,6-dihydrobenzo[b][1]benzothiepin-6-amine.
| Compound Name | (6S)-3-chloro-N,N-diethyl-5,6-dihydrobenzo[b][1]benzothiepin-6-amine |
|---|---|
| PubChem CID | 826443 |
| Molecular Formula | C18H20ClNS |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (6S)-3-chloro-N,N-diethyl-5,6-dihydrobenzo[b][1]benzothiepin-6-amine |
| SMILES | CCN(CC)[C@H]1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H20ClNS/c1-3-20(4-2)16-12-13-11-14(19)9-10-17(13)21-18-8-6-5-7-15(16)18/h5-11,16H,3-4,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | GGNVCJRUKKSYML-INIZCTEOSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|