C18H21ClN2S — CID 92759401
N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 92759401) has the molecular formula C18H21ClN2S and a molecular weight of 332.90 g/mol. Its IUPAC name is N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 92759401 |
| Molecular Formula | C18H21ClN2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCN[C@@H]1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H21ClN2S/c1-21(2)10-9-20-16-12-13-11-14(19)7-8-17(13)22-18-6-4-3-5-15(16)18/h3-8,11,16,20H,9-10,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | DYRGNAWDGFZLMW-MRXNPFEDSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|