C22H26ClN3O2S — CID 97498811
N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide (PubChem CID 97498811) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 97498811 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[(6R)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCO)CC1)N[C@@H]1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H26ClN3O2S/c23-17-5-6-20-16(13-17)14-19(18-3-1-2-4-21(18)29-20)24-22(28)15-26-9-7-25(8-10-26)11-12-27/h1-6,13,19,27H,7-12,14-15H2,(H,24,28)/t19-/m1/s1 |
| InChIKey | NNBUVIDQCALOBO-LJQANCHMSA-N |
| XLogP | 2.81 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|