C26H32ClN3O3S — CID 24840196
2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethyl 2-morpholin-4-ylacetate (PubChem CID 24840196) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is 2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethyl 2-morpholin-4-ylacetate.
| Compound Name | 2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethyl 2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 24840196 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethyl 2-morpholin-4-ylacetate |
| SMILES | O=C(CN1CCOCC1)OCCN1CCN(C2Cc3cc(Cl)ccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C26H32ClN3O3S/c27-21-5-6-24-20(17-21)18-23(22-3-1-2-4-25(22)34-24)30-9-7-28(8-10-30)13-16-33-26(31)19-29-11-14-32-15-12-29/h1-6,17,23H,7-16,18-19H2 |
| InChIKey | LLCJHKKLVRLHND-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|