C28H29ClN2O3S — CID 1032864
2-[4-[(6S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]piperazin-1-yl]ethyl 2-phenoxyacetate (PubChem CID 1032864) has the molecular formula C28H29ClN2O3S and a molecular weight of 509.07 g/mol. Its IUPAC name is 2-[4-[(6S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]piperazin-1-yl]ethyl 2-phenoxyacetate.
| Compound Name | 2-[4-[(6S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]piperazin-1-yl]ethyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 1032864 |
| Molecular Formula | C28H29ClN2O3S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-[4-[(6S)-3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl]piperazin-1-yl]ethyl 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OCCN1CCN([C@H]2Cc3cc(Cl)ccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C28H29ClN2O3S/c29-22-10-11-26-21(18-22)19-25(24-8-4-5-9-27(24)35-26)31-14-12-30(13-15-31)16-17-33-28(32)20-34-23-6-2-1-3-7-23/h1-11,18,25H,12-17,19-20H2/t25-/m0/s1 |
| InChIKey | UMEUVBACWNKQTN-VWLOTQADSA-N |
| XLogP | 5.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|