C19H22NS+ — CID 6947800
1-[(5S)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperidin-1-ium (PubChem CID 6947800) has the molecular formula C19H22NS+ and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[(5S)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperidin-1-ium.
| Compound Name | 1-[(5S)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 6947800 |
| Molecular Formula | C19H22NS+ |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[(5S)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperidin-1-ium |
| SMILES | c1ccc2c(c1)C[C@H]([NH+]1CCCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C19H21NS/c1-6-12-20(13-7-1)17-14-15-8-2-4-10-18(15)21-19-11-5-3-9-16(17)19/h2-5,8-11,17H,1,6-7,12-14H2/p+1/t17-/m0/s1 |
| InChIKey | UTNUUYXIIWEJCI-KRWDZBQOSA-O |
| XLogP | 3.50 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|