C15H24N2+2 — CID 9168726
(4R)-4-(azepan-1-ium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 9168726) has the molecular formula C15H24N2+2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (4R)-4-(azepan-1-ium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (4R)-4-(azepan-1-ium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 9168726 |
| Molecular Formula | C15H24N2+2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (4R)-4-(azepan-1-ium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | c1ccc2c(c1)C[NH2+]C[C@@H]2[NH+]1CCCCCC1 |
| InChI | InChI=1S/C15H22N2/c1-2-6-10-17(9-5-1)15-12-16-11-13-7-3-4-8-14(13)15/h3-4,7-8,15-16H,1-2,5-6,9-12H2/p+2/t15-/m0/s1 |
| InChIKey | CZCRVFWUEFTNSY-HNNXBMFYSA-P |
| XLogP | 0.26 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |