C19H22N2OS — CID 3038760
4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-1-methyl-1-oxidopiperazin-1-ium (PubChem CID 3038760) has the molecular formula C19H22N2OS and a molecular weight of 326.46 g/mol. Its IUPAC name is 4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-1-methyl-1-oxidopiperazin-1-ium.
| Compound Name | 4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-1-methyl-1-oxidopiperazin-1-ium |
|---|---|
| PubChem CID | 3038760 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-1-methyl-1-oxidopiperazin-1-ium |
| SMILES | C[N+]1([O-])CCN(C2Cc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C19H22N2OS/c1-21(22)12-10-20(11-13-21)17-14-15-6-2-4-8-18(15)23-19-9-5-3-7-16(17)19/h2-9,17H,10-14H2,1H3 |
| InChIKey | JUCNHVYABXPTIZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|