C13H10ClNS — CID 6928885
(2R)-2-(2-chlorophenyl)-2,3-dihydro-1,3-benzothiazole (PubChem CID 6928885) has the molecular formula C13H10ClNS and a molecular weight of 247.75 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2,3-dihydro-1,3-benzothiazole.
| Compound Name | (2R)-2-(2-chlorophenyl)-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 6928885 |
| Molecular Formula | C13H10ClNS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2,3-dihydro-1,3-benzothiazole |
| SMILES | Clc1ccccc1[C@@H]1Nc2ccccc2S1 |
| InChI | InChI=1S/C13H10ClNS/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8,13,15H/t13-/m1/s1 |
| InChIKey | NQUFSFGPHJRGPH-CYBMUJFWSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |