C20H15ClN4S — CID 12786995
2-(6-chloro-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-5-yl)-2,3-dihydro-1,3-benzothiazole (PubChem CID 12786995) has the molecular formula C20H15ClN4S and a molecular weight of 378.89 g/mol. Its IUPAC name is 2-(6-chloro-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-5-yl)-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 2-(6-chloro-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-5-yl)-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 12786995 |
| Molecular Formula | C20H15ClN4S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-(6-chloro-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-5-yl)-2,3-dihydro-1,3-benzothiazole |
| SMILES | Cc1nn(-c2ccccc2)c2nc(Cl)c(C3Nc4ccccc4S3)cc12 |
| InChI | InChI=1S/C20H15ClN4S/c1-12-14-11-15(20-22-16-9-5-6-10-17(16)26-20)18(21)23-19(14)25(24-12)13-7-3-2-4-8-13/h2-11,20,22H,1H3 |
| InChIKey | LZRBPBSIISATKC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|