C24H23ClN4O2 — CID 12786992
1-(6-chloro-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]methanimine (PubChem CID 12786992) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 1-(6-chloro-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]methanimine.
| Compound Name | 1-(6-chloro-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 12786992 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-(6-chloro-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]methanimine |
| SMILES | COc1ccc(CC/N=C/c2cc3c(C)nn(-c4ccccc4)c3nc2Cl)cc1OC |
| InChI | InChI=1S/C24H23ClN4O2/c1-16-20-14-18(15-26-12-11-17-9-10-21(30-2)22(13-17)31-3)23(25)27-24(20)29(28-16)19-7-5-4-6-8-19/h4-10,13-15H,11-12H2,1-3H3/b26-15+ |
| InChIKey | XMNYTGRNBVXBHV-CVKSISIWSA-N |
| XLogP | 5.06 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|