C20H20F2N4O3 — CID 27883567
N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 27883567) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 27883567 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2nn(-c3ccccc3)nc2C)ccc1OC(F)F |
| InChI | InChI=1S/C20H20F2N4O3/c1-13-18(25-26(24-13)15-6-4-3-5-7-15)19(27)23-11-10-14-8-9-16(29-20(21)22)17(12-14)28-2/h3-9,12,20H,10-11H2,1-2H3,(H,23,27) |
| InChIKey | QCUCGVLKCNFCMF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |