C16H18Cl2O2Si — CID 139667876
dichloro-[2-(3,4-dimethoxyphenyl)ethyl]-phenylsilane (PubChem CID 139667876) has the molecular formula C16H18Cl2O2Si and a molecular weight of 341.31 g/mol. Its IUPAC name is dichloro-[2-(3,4-dimethoxyphenyl)ethyl]-phenylsilane.
| Compound Name | dichloro-[2-(3,4-dimethoxyphenyl)ethyl]-phenylsilane |
|---|---|
| PubChem CID | 139667876 |
| Molecular Formula | C16H18Cl2O2Si |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | dichloro-[2-(3,4-dimethoxyphenyl)ethyl]-phenylsilane |
| SMILES | COc1ccc(CC[Si](Cl)(Cl)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18Cl2O2Si/c1-19-15-9-8-13(12-16(15)20-2)10-11-21(17,18)14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | RJNORDBPAZBBJU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|