C29H30IO2P — CID 10940771
3-(3,4-dimethoxyphenyl)propyl-triphenylphosphanium iodide (PubChem CID 10940771) has the molecular formula C29H30IO2P and a molecular weight of 568.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)propyl-triphenylphosphanium iodide.
| Compound Name | 3-(3,4-dimethoxyphenyl)propyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 10940771 |
| Molecular Formula | C29H30IO2P |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)propyl-triphenylphosphanium iodide |
| SMILES | COc1ccc(CCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1OC.[I-] |
| InChI | InChI=1S/C29H30O2P.HI/c1-30-28-21-20-24(23-29(28)31-2)13-12-22-32(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27;/h3-11,14-21,23H,12-13,22H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BXXBWPUPHZVRNE-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|