C21H28O5 — CID 54375064
4-[4-(3,4-dimethoxyphenyl)-1-methoxybutyl]-1,2-dimethoxybenzene (PubChem CID 54375064) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-[4-(3,4-dimethoxyphenyl)-1-methoxybutyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[4-(3,4-dimethoxyphenyl)-1-methoxybutyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 54375064 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-[4-(3,4-dimethoxyphenyl)-1-methoxybutyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CCCC(OC)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H28O5/c1-22-17(16-10-12-19(24-3)21(14-16)26-5)8-6-7-15-9-11-18(23-2)20(13-15)25-4/h9-14,17H,6-8H2,1-5H3 |
| InChIKey | UVXJAUBNQDPBTK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |