C19H26ClNO3 — CID 110176932
2-(3,4-dimethoxyphenyl)ethyl-(2-methoxy-2-phenylethyl)azanium chloride (PubChem CID 110176932) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-(2-methoxy-2-phenylethyl)azanium chloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-(2-methoxy-2-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 110176932 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-(2-methoxy-2-phenylethyl)azanium chloride |
| SMILES | COc1ccc(CC[NH2+]CC(OC)c2ccccc2)cc1OC.[Cl-] |
| InChI | InChI=1S/C19H25NO3.ClH/c1-21-17-10-9-15(13-18(17)22-2)11-12-20-14-19(23-3)16-7-5-4-6-8-16;/h4-10,13,19-20H,11-12,14H2,1-3H3;1H |
| InChIKey | SSCKHCRCXYUGJV-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|