C21H29N3O3 — CID 111201060
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-methoxy-2-phenylethyl)guanidine (PubChem CID 111201060) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-methoxy-2-phenylethyl)guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-methoxy-2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111201060 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-methoxy-2-phenylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC(OC)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-5-22-21(24-15-20(27-4)17-9-7-6-8-10-17)23-14-16-11-12-18(25-2)19(13-16)26-3/h6-13,20H,5,14-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | SYWQPXTUYSKSDJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|