C21H29NO3 — CID 175825674
6-(3,4-dimethoxyphenyl)-1-(2-methoxyphenyl)hexan-3-amine (PubChem CID 175825674) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-1-(2-methoxyphenyl)hexan-3-amine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-1-(2-methoxyphenyl)hexan-3-amine |
|---|---|
| PubChem CID | 175825674 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-1-(2-methoxyphenyl)hexan-3-amine |
| SMILES | COc1ccccc1CCC(N)CCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H29NO3/c1-23-19-10-5-4-8-17(19)12-13-18(22)9-6-7-16-11-14-20(24-2)21(15-16)25-3/h4-5,8,10-11,14-15,18H,6-7,9,12-13,22H2,1-3H3 |
| InChIKey | GLIZCEKFCVEETP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |