C26H36N2O4 — CID 94865428
(2R,6R)-6-amino-2,8-bis(3,4-dimethoxyphenyl)-2-ethyloctanenitrile (PubChem CID 94865428) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (2R,6R)-6-amino-2,8-bis(3,4-dimethoxyphenyl)-2-ethyloctanenitrile.
| Compound Name | (2R,6R)-6-amino-2,8-bis(3,4-dimethoxyphenyl)-2-ethyloctanenitrile |
|---|---|
| PubChem CID | 94865428 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (2R,6R)-6-amino-2,8-bis(3,4-dimethoxyphenyl)-2-ethyloctanenitrile |
| SMILES | CC[C@@](C#N)(CCC[C@@H](N)CCc1ccc(OC)c(OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H36N2O4/c1-6-26(18-27,20-11-14-23(30-3)25(17-20)32-5)15-7-8-21(28)12-9-19-10-13-22(29-2)24(16-19)31-4/h10-11,13-14,16-17,21H,6-9,12,15,28H2,1-5H3/t21-,26+/m1/s1 |
| InChIKey | FXLNXOBHZFCAMR-RLWLMLJZSA-N |
| XLogP | 5.02 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |