C27H36N2O4 — CID 139909928
(2S)-2-(3,4-dimethoxyphenyl)-2-[3-[3-(3,4-dimethoxyphenyl)propylamino]propyl]pent-4-enenitrile (PubChem CID 139909928) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-2-[3-[3-(3,4-dimethoxyphenyl)propylamino]propyl]pent-4-enenitrile.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-2-[3-[3-(3,4-dimethoxyphenyl)propylamino]propyl]pent-4-enenitrile |
|---|---|
| PubChem CID | 139909928 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-2-[3-[3-(3,4-dimethoxyphenyl)propylamino]propyl]pent-4-enenitrile |
| SMILES | C=CC[C@@](C#N)(CCCNCCCc1ccc(OC)c(OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H36N2O4/c1-6-14-27(20-28,22-11-13-24(31-3)26(19-22)33-5)15-8-17-29-16-7-9-21-10-12-23(30-2)25(18-21)32-4/h6,10-13,18-19,29H,1,7-9,14-17H2,2-5H3/t27-/m0/s1 |
| InChIKey | UFJYZGBPFFRWRZ-MHZLTWQESA-N |
| XLogP | 5.06 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|