C17H13NS — CID 102081822
(2R)-2-naphthalen-1-yl-2,3-dihydro-1,3-benzothiazole (PubChem CID 102081822) has the molecular formula C17H13NS and a molecular weight of 263.37 g/mol. Its IUPAC name is (2R)-2-naphthalen-1-yl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | (2R)-2-naphthalen-1-yl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 102081822 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2R)-2-naphthalen-1-yl-2,3-dihydro-1,3-benzothiazole |
| SMILES | c1ccc2c(c1)N[C@@H](c1cccc3ccccc13)S2 |
| InChI | InChI=1S/C17H13NS/c1-2-8-13-12(6-1)7-5-9-14(13)17-18-15-10-3-4-11-16(15)19-17/h1-11,17-18H/t17-/m1/s1 |
| InChIKey | ZXRCEWIJIAARES-QGZVFWFLSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |