C17H13NS2 — CID 139620869
2-naphthalen-1-yl-3-sulfanyl-2H-1,3-benzothiazole (PubChem CID 139620869) has the molecular formula C17H13NS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-naphthalen-1-yl-3-sulfanyl-2H-1,3-benzothiazole.
| Compound Name | 2-naphthalen-1-yl-3-sulfanyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 139620869 |
| Molecular Formula | C17H13NS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-naphthalen-1-yl-3-sulfanyl-2H-1,3-benzothiazole |
| SMILES | SN1c2ccccc2SC1c1cccc2ccccc12 |
| InChI | InChI=1S/C17H13NS2/c19-18-15-10-3-4-11-16(15)20-17(18)14-9-5-7-12-6-1-2-8-13(12)14/h1-11,17,19H |
| InChIKey | RAZQBSVVGBGYNV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|