C13H10O2 — CID 67839712
2-naphthalen-1-yl-1,3-dioxole (PubChem CID 67839712) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-naphthalen-1-yl-1,3-dioxole.
| Compound Name | 2-naphthalen-1-yl-1,3-dioxole |
|---|---|
| PubChem CID | 67839712 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-naphthalen-1-yl-1,3-dioxole |
| SMILES | C1=COC(c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C13H10O2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-9,13H |
| InChIKey | MYMPRMNIVLVJCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |