C22H26O4 — CID 151375847
5,5-dibutyl-2-naphthalen-1-yl-1,3-dioxane-4,6-dione (PubChem CID 151375847) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 5,5-dibutyl-2-naphthalen-1-yl-1,3-dioxane-4,6-dione.
| Compound Name | 5,5-dibutyl-2-naphthalen-1-yl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 151375847 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 5,5-dibutyl-2-naphthalen-1-yl-1,3-dioxane-4,6-dione |
| SMILES | CCCCC1(CCCC)C(=O)OC(c2cccc3ccccc23)OC1=O |
| InChI | InChI=1S/C22H26O4/c1-3-5-14-22(15-6-4-2)20(23)25-19(26-21(22)24)18-13-9-11-16-10-7-8-12-17(16)18/h7-13,19H,3-6,14-15H2,1-2H3 |
| InChIKey | ORJYOSYLIRONPX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|