C16H14 — CID 15535611
1-cyclohexa-2,5-dien-1-ylnaphthalene (PubChem CID 15535611) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-cyclohexa-2,5-dien-1-ylnaphthalene.
| Compound Name | 1-cyclohexa-2,5-dien-1-ylnaphthalene |
|---|---|
| PubChem CID | 15535611 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-cyclohexa-2,5-dien-1-ylnaphthalene |
| SMILES | C1=CC(c2cccc3ccccc23)C=CC1 |
| InChI | InChI=1S/C16H14/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h2-13H,1H2 |
| InChIKey | GHJPFWXEGVIHRS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|