C13H13NO — CID 124638979
(2R,3S)-2-naphthalen-1-ylazetidin-3-ol (PubChem CID 124638979) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (2R,3S)-2-naphthalen-1-ylazetidin-3-ol.
| Compound Name | (2R,3S)-2-naphthalen-1-ylazetidin-3-ol |
|---|---|
| PubChem CID | 124638979 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2R,3S)-2-naphthalen-1-ylazetidin-3-ol |
| SMILES | O[C@H]1CN[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C13H13NO/c15-12-8-14-13(12)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-15H,8H2/t12-,13+/m0/s1 |
| InChIKey | LNTRRNVAZRBUNS-QWHCGFSZSA-N |
| XLogP | 1.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |