C25H24O4 — CID 162037384
(2R,3S,4R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolane-3,4-diol;naphthalene (PubChem CID 162037384) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolane-3,4-diol;naphthalene.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolane-3,4-diol;naphthalene |
|---|---|
| PubChem CID | 162037384 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolane-3,4-diol;naphthalene |
| SMILES | OC[C@H]1OC(c2cccc3ccccc23)[C@H](O)[C@@H]1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16O4.C10H8/c16-8-12-13(17)14(18)15(19-12)11-7-3-5-9-4-1-2-6-10(9)11;1-2-6-10-8-4-3-7-9(10)5-1/h1-7,12-18H,8H2;1-8H/t12-,13-,14-,15?;/m1./s1 |
| InChIKey | YWVCIOXISAZIHD-NUWOWBIJSA-N |
| XLogP | 3.83 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |