C16H18O6 — CID 154944068
(3R,4S,5S,6R)-6-(hydroxymethyl)-3-naphthalen-1-yloxane-2,3,4,5-tetrol (PubChem CID 154944068) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)-3-naphthalen-1-yloxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-3-naphthalen-1-yloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 154944068 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-3-naphthalen-1-yloxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC(O)[C@@](O)(c2cccc3ccccc23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O6/c17-8-12-13(18)14(19)16(21,15(20)22-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-15,17-21H,8H2/t12-,13-,14+,15?,16-/m1/s1 |
| InChIKey | ZKDKCARJOWNZRI-WOFIAXNJSA-N |
| XLogP | -0.54 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |