C12H16O6 — CID 57135995
(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3-phenyloxane-2,3,4,5-tetrol (PubChem CID 57135995) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3-phenyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3-phenyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57135995 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3-phenyloxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@H](O)[C@@](O)(c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16O6/c13-6-8-9(14)10(15)12(17,11(16)18-8)7-4-2-1-3-5-7/h1-5,8-11,13-17H,6H2/t8-,9+,10+,11+,12-/m1/s1 |
| InChIKey | OMOVOMAXXAWMFC-WTPMCQDGSA-N |
| XLogP | -1.69 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |