C7H15NO6 — CID 176884296
(3S,4R,5R,6S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,3,4,5-tetrol (PubChem CID 176884296) has the molecular formula C7H15NO6 and a molecular weight of 209.20 g/mol. Its IUPAC name is (3S,4R,5R,6S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5R,6S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 176884296 |
| Molecular Formula | C7H15NO6 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (3S,4R,5R,6S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,3,4,5-tetrol |
| SMILES | CN[C@@]1(O)C(O)O[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15NO6/c1-8-7(13)5(11)4(10)3(2-9)14-6(7)12/h3-6,8-13H,2H2,1H3/t3-,4-,5+,6?,7-/m0/s1 |
| InChIKey | FFWWKQYEDZQGTP-JMSNOUGXSA-N |
| XLogP | -3.67 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|