C8H15NO7 — CID 18659288
N-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 18659288) has the molecular formula C8H15NO7 and a molecular weight of 237.21 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 18659288 |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@]1(O)[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H15NO7/c1-3(11)9-8(15)6(13)5(12)4(2-10)16-7(8)14/h4-7,10,12-15H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | HTYJJXAGFJMZML-JAJWTYFOSA-N |
| XLogP | -3.76 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|