C8H16NO10P — CID 100923877
[(2R,3S,4S,5R)-5-acetamido-3,4,5,6-tetrahydroxyoxan-2-yl]methyl dihydrogen phosphate (PubChem CID 100923877) has the molecular formula C8H16NO10P and a molecular weight of 317.19 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-acetamido-3,4,5,6-tetrahydroxyoxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-acetamido-3,4,5,6-tetrahydroxyoxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 100923877 |
| Molecular Formula | C8H16NO10P |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [(2R,3S,4S,5R)-5-acetamido-3,4,5,6-tetrahydroxyoxan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)N[C@]1(O)C(O)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16NO10P/c1-3(10)9-8(14)6(12)5(11)4(19-7(8)13)2-18-20(15,16)17/h4-7,11-14H,2H2,1H3,(H,9,10)(H2,15,16,17)/t4-,5-,6+,7?,8-/m1/s1 |
| InChIKey | RMZBWDXUVJFFJH-JTFAZQEDSA-N |
| XLogP | -3.64 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|