C9H16ClN3O8 — CID 90855700
1-(2-chloroethyl)-1-nitroso-3-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 90855700) has the molecular formula C9H16ClN3O8 and a molecular weight of 329.69 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 90855700 |
| Molecular Formula | C9H16ClN3O8 |
| Molecular Weight | 329.69 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | O=NN(CCCl)C(=O)N[C@]1(O)[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16ClN3O8/c10-1-2-13(12-20)8(18)11-9(19)6(16)5(15)4(3-14)21-7(9)17/h4-7,14-17,19H,1-3H2,(H,11,18)/t4-,5-,6+,7+,9-/m1/s1 |
| InChIKey | FHMFWWOYUUUSRX-CRYJZLASSA-N |
| XLogP | -2.96 |
| TPSA | 172.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.69 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|