C13H24ClN3O7 — CID 57306277
1-butyl-3-(2-chloroethyl)-3-nitroso-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea (PubChem CID 57306277) has the molecular formula C13H24ClN3O7 and a molecular weight of 369.80 g/mol. Its IUPAC name is 1-butyl-3-(2-chloroethyl)-3-nitroso-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea.
| Compound Name | 1-butyl-3-(2-chloroethyl)-3-nitroso-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 57306277 |
| Molecular Formula | C13H24ClN3O7 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-butyl-3-(2-chloroethyl)-3-nitroso-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
| SMILES | CCCCN(C(=O)N(CCCl)N=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24ClN3O7/c1-2-3-5-16(13(22)17(15-23)6-4-14)12-11(21)10(20)9(19)8(7-18)24-12/h8-12,18-21H,2-7H2,1H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | CQFUKQVDSKZNGV-RMPHRYRLSA-N |
| XLogP | -0.77 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|