C13H22ClN3O7 — CID 88754550
1-(2-chloroethyl)-3-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitroso-3-prop-2-enylurea (PubChem CID 88754550) has the molecular formula C13H22ClN3O7 and a molecular weight of 367.79 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitroso-3-prop-2-enylurea.
| Compound Name | 1-(2-chloroethyl)-3-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitroso-3-prop-2-enylurea |
|---|---|
| PubChem CID | 88754550 |
| Molecular Formula | C13H22ClN3O7 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitroso-3-prop-2-enylurea |
| SMILES | C=CCN(C(=O)N(CCCl)N=O)[C@H]1[C@@H](O)[C@@H](OC)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C13H22ClN3O7/c1-3-5-16(13(21)17(15-22)6-4-14)9-10(19)8(7-18)24-12(23-2)11(9)20/h3,8-12,18-20H,1,4-7H2,2H3/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | SAZFWTFVWMEGHF-OOCWMUITSA-N |
| XLogP | -0.73 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|