C14H27ClN2O6 — CID 70553681
3-(2-chloroethyl)-1-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-(2-methylpropyl)urea (PubChem CID 70553681) has the molecular formula C14H27ClN2O6 and a molecular weight of 354.83 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-(2-methylpropyl)urea.
| Compound Name | 3-(2-chloroethyl)-1-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 70553681 |
| Molecular Formula | C14H27ClN2O6 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-(2-chloroethyl)-1-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-(2-methylpropyl)urea |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@@H](N(CC(C)C)C(=O)NCCCl)[C@H]1O |
| InChI | InChI=1S/C14H27ClN2O6/c1-8(2)6-17(14(21)16-5-4-15)10-11(19)9(7-18)23-13(22-3)12(10)20/h8-13,18-20H,4-7H2,1-3H3,(H,16,21)/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | DPTKBBSRMUSAAK-VEGXAWMVSA-N |
| XLogP | -0.65 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|