C20H37ClN2O11 — CID 54543219
3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-pentylurea (PubChem CID 54543219) has the molecular formula C20H37ClN2O11 and a molecular weight of 516.97 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-pentylurea.
| Compound Name | 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-pentylurea |
|---|---|
| PubChem CID | 54543219 |
| Molecular Formula | C20H37ClN2O11 |
| Molecular Weight | 516.97 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-pentylurea |
| SMILES | CCCCCN(C(=O)NCCCl)C1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H37ClN2O11/c1-2-3-4-7-23(20(31)22-6-5-21)18-15(29)14(28)17(11(9-25)32-18)34-19-16(30)13(27)12(26)10(8-24)33-19/h10-19,24-30H,2-9H2,1H3,(H,22,31)/t10-,11-,12-,13+,14-,15-,16-,17-,18?,19-/m1/s1 |
| InChIKey | ZERWAMQPVORZSX-JADVVPACSA-N |
| XLogP | -2.95 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.97 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|